C30H36F3N5O5S — CID 175138246
tert-butyl (3R)-3-[[5,7,11-triamino-7-[2-methyl-4-(trifluoromethoxy)phenyl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 175138246) has the molecular formula C30H36F3N5O5S and a molecular weight of 635.71 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[5,7,11-triamino-7-[2-methyl-4-(trifluoromethoxy)phenyl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[5,7,11-triamino-7-[2-methyl-4-(trifluoromethoxy)phenyl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175138246 |
| Molecular Formula | C30H36F3N5O5S |
| Molecular Weight | 635.71 g/mol |
| Exact Mass | 635.24 |
| IUPAC Name | tert-butyl (3R)-3-[[5,7,11-triamino-7-[2-methyl-4-(trifluoromethoxy)phenyl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | Cc1cc(OC(F)(F)F)ccc1C1(N)C(=O)C(N)C2c3c1ccc(N)c3SC2C(=O)N[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C30H36F3N5O5S/c1-14-12-16(42-30(31,32)33)7-8-17(14)29(36)18-9-10-19(34)23-20(18)21(22(35)25(29)39)24(44-23)26(40)37-15-6-5-11-38(13-15)27(41)43-28(2,3)4/h7-10,12,15,21-22,24H,5-6,11,13,34-36H2,1-4H3,(H,37,40)/t15-,21?,22?,24?,29?/m1/s1 |
| InChIKey | QKBAGQPKBHCNTE-NSBSBWFYSA-N |
| XLogP | 3.66 |
| TPSA | 163.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.71 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|