C31H32FN5O5S — CID 175138346
3-[[(5R,7R)-5,7,11-triamino-5-fluoro-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]piperidine-1-carboxylic acid (PubChem CID 175138346) has the molecular formula C31H32FN5O5S and a molecular weight of 605.69 g/mol. Its IUPAC name is 3-[[(5R,7R)-5,7,11-triamino-5-fluoro-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]piperidine-1-carboxylic acid.
| Compound Name | 3-[[(5R,7R)-5,7,11-triamino-5-fluoro-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175138346 |
| Molecular Formula | C31H32FN5O5S |
| Molecular Weight | 605.69 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | 3-[[(5R,7R)-5,7,11-triamino-5-fluoro-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]piperidine-1-carboxylic acid |
| SMILES | Cc1cc(Oc2ccccc2)ccc1[C@]1(N)C(=O)[C@](N)(F)C2c3c1ccc(N)c3SC2C(=O)NC1CCCN(C(=O)O)C1 |
| InChI | InChI=1S/C31H32FN5O5S/c1-16-14-19(42-18-7-3-2-4-8-18)9-10-20(16)30(34)21-11-12-22(33)25-23(21)24(31(32,35)28(30)39)26(43-25)27(38)36-17-6-5-13-37(15-17)29(40)41/h2-4,7-12,14,17,24,26H,5-6,13,15,33-35H2,1H3,(H,36,38)(H,40,41)/t17?,24?,26?,30-,31+/m1/s1 |
| InChIKey | UTMXXVXIXLPVDT-QUUKCQIVSA-N |
| XLogP | 3.60 |
| TPSA | 174.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.69 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|