C30H30N8O4S — CID 175138784
5,7,11-triamino-7-(2-methyl-6-pyrimidin-5-yloxy-3-pyridinyl)-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175138784) has the molecular formula C30H30N8O4S and a molecular weight of 598.69 g/mol. Its IUPAC name is 5,7,11-triamino-7-(2-methyl-6-pyrimidin-5-yloxy-3-pyridinyl)-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-7-(2-methyl-6-pyrimidin-5-yloxy-3-pyridinyl)-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175138784 |
| Molecular Formula | C30H30N8O4S |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | 5,7,11-triamino-7-(2-methyl-6-pyrimidin-5-yloxy-3-pyridinyl)-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCC[C@H]1NC(=O)c1sc2c(N)ccc3c2c1C(N)C(=O)C3(N)c1ccc(Oc2cncnc2)nc1C |
| InChI | InChI=1S/C30H30N8O4S/c1-3-21(39)37-19-5-4-6-20(19)38-29(41)27-24-23-17(7-9-18(31)26(23)43-27)30(33,28(40)25(24)32)16-8-10-22(36-14(16)2)42-15-11-34-13-35-12-15/h3,7-13,19-20,25H,1,4-6,31-33H2,2H3,(H,37,39)(H,38,41)/t19-,20+,25?,30?/m0/s1 |
| InChIKey | YPYCNCTXQCWFBK-PCTKLOPJSA-N |
| XLogP | 2.51 |
| TPSA | 201.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|