C24H29N5O3S — CID 175139286
5,7,11-triamino-7-(4-methoxy-2-methylphenyl)-6-oxo-N-pyrrolidin-3-yl-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carboxamide (PubChem CID 175139286) has the molecular formula C24H29N5O3S and a molecular weight of 467.60 g/mol. Its IUPAC name is 5,7,11-triamino-7-(4-methoxy-2-methylphenyl)-6-oxo-N-pyrrolidin-3-yl-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carboxamide.
| Compound Name | 5,7,11-triamino-7-(4-methoxy-2-methylphenyl)-6-oxo-N-pyrrolidin-3-yl-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carboxamide |
|---|---|
| PubChem CID | 175139286 |
| Molecular Formula | C24H29N5O3S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 5,7,11-triamino-7-(4-methoxy-2-methylphenyl)-6-oxo-N-pyrrolidin-3-yl-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carboxamide |
| SMILES | COc1ccc(C2(N)C(=O)C(N)C3c4c2ccc(N)c4SC3C(=O)NC2CCNC2)c(C)c1 |
| InChI | InChI=1S/C24H29N5O3S/c1-11-9-13(32-2)3-4-14(11)24(27)15-5-6-16(25)20-17(15)18(19(26)22(24)30)21(33-20)23(31)29-12-7-8-28-10-12/h3-6,9,12,18-19,21,28H,7-8,10,25-27H2,1-2H3,(H,29,31) |
| InChIKey | RMKMUWBXVVONIO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 145.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|