C29H30N6O3S — CID 175139339
methane;N-[1-(oxiran-2-ylmethyl)piperidin-3-yl]-6-oxo-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175139339) has the molecular formula C29H30N6O3S and a molecular weight of 542.67 g/mol. Its IUPAC name is methane;N-[1-(oxiran-2-ylmethyl)piperidin-3-yl]-6-oxo-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | methane;N-[1-(oxiran-2-ylmethyl)piperidin-3-yl]-6-oxo-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175139339 |
| Molecular Formula | C29H30N6O3S |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | methane;N-[1-(oxiran-2-ylmethyl)piperidin-3-yl]-6-oxo-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C.O=C(NC1CCCN(CC2CO2)C1)c1sc2nccc3c2c1NC(=O)N3c1ccnc(-c2ccccc2)c1 |
| InChI | InChI=1S/C28H26N6O3S.CH4/c35-26(31-18-7-4-12-33(14-18)15-20-16-37-20)25-24-23-22(9-11-30-27(23)38-25)34(28(36)32-24)19-8-10-29-21(13-19)17-5-2-1-3-6-17;/h1-3,5-6,8-11,13,18,20H,4,7,12,14-16H2,(H,31,35)(H,32,36);1H4 |
| InChIKey | JUCHBIRGOSFXIL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 102.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|