C9H13NS2 — CID 175139494
4-pyridin-2-ylbutane-1,1-dithiol (PubChem CID 175139494) has the molecular formula C9H13NS2 and a molecular weight of 199.34 g/mol. Its IUPAC name is 4-pyridin-2-ylbutane-1,1-dithiol.
| Compound Name | 4-pyridin-2-ylbutane-1,1-dithiol |
|---|---|
| PubChem CID | 175139494 |
| Molecular Formula | C9H13NS2 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 4-pyridin-2-ylbutane-1,1-dithiol |
| SMILES | SC(S)CCCc1ccccn1 |
| InChI | InChI=1S/C9H13NS2/c11-9(12)6-3-5-8-4-1-2-7-10-8/h1-2,4,7,9,11-12H,3,5-6H2 |
| InChIKey | MQNMBPNKGGVWLW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|