C12H18F3N3O3 — CID 175139625
2,3-dimethyl-6-(3,3,3-trifluoropropanoylamino)hept-2-enediamide (PubChem CID 175139625) has the molecular formula C12H18F3N3O3 and a molecular weight of 309.29 g/mol. Its IUPAC name is 2,3-dimethyl-6-(3,3,3-trifluoropropanoylamino)hept-2-enediamide.
| Compound Name | 2,3-dimethyl-6-(3,3,3-trifluoropropanoylamino)hept-2-enediamide |
|---|---|
| PubChem CID | 175139625 |
| Molecular Formula | C12H18F3N3O3 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2,3-dimethyl-6-(3,3,3-trifluoropropanoylamino)hept-2-enediamide |
| SMILES | CC(CCC(NC(=O)CC(F)(F)F)C(N)=O)=C(C)C(N)=O |
| InChI | InChI=1S/C12H18F3N3O3/c1-6(7(2)10(16)20)3-4-8(11(17)21)18-9(19)5-12(13,14)15/h8H,3-5H2,1-2H3,(H2,16,20)(H2,17,21)(H,18,19) |
| InChIKey | SKYRZNQZNMAFRO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|