C33H39N5O4S — CID 175139692
tert-butyl 4-[5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-yl]piperazine-1-carboxylate (PubChem CID 175139692) has the molecular formula C33H39N5O4S and a molecular weight of 601.77 g/mol. Its IUPAC name is tert-butyl 4-[5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175139692 |
| Molecular Formula | C33H39N5O4S |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.27 |
| IUPAC Name | tert-butyl 4-[5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-yl]piperazine-1-carboxylate |
| SMILES | Cc1cc(Oc2ccccc2)ccc1C1(N)C(=O)C(N)C2c3c1ccc(N)c3SC2N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C33H39N5O4S/c1-19-18-21(41-20-8-6-5-7-9-20)10-11-22(19)33(36)23-12-13-24(34)28-25(23)26(27(35)29(33)39)30(43-28)37-14-16-38(17-15-37)31(40)42-32(2,3)4/h5-13,18,26-27,30H,14-17,34-36H2,1-4H3 |
| InChIKey | WMKQJDZRCSVJQY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 137.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|