About 2-pent-2-enyl-4-propyl-1,3-oxathiolane
2-pent-2-enyl-4-propyl-1,3-oxathiolane (PubChem CID 175140200) has the molecular formula C11H20OS
and a molecular weight of 200.35 g/mol. Its IUPAC name is 2-pent-2-enyl-4-propyl-1,3-oxathiolane.
Molecular Properties
| Compound Name | 2-pent-2-enyl-4-propyl-1,3-oxathiolane |
| PubChem CID | 175140200 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-pent-2-enyl-4-propyl-1,3-oxathiolane |
| SMILES | CCC=CCC1OCC(CCC)S1 |
| InChI | InChI=1S/C11H20OS/c1-3-5-6-8-11-12-9-10(13-11)7-4-2/h5-6,10-11H,3-4,7-9H2,1-2H3 |
| InChIKey | CCDBBGQBGWTPAS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-pent-2-enyl-4-propyl-1,3-oxathiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pent-2-enyl-4-propyl-1,3-oxathiolane?
The IUPAC name of 2-pent-2-enyl-4-propyl-1,3-oxathiolane (CID 175140200) is 2-pent-2-enyl-4-propyl-1,3-oxathiolane.
What is the SMILES notation for 2-pent-2-enyl-4-propyl-1,3-oxathiolane?
The canonical SMILES for 2-pent-2-enyl-4-propyl-1,3-oxathiolane is CCC=CCC1OCC(CCC)S1.
What is the InChIKey of 2-pent-2-enyl-4-propyl-1,3-oxathiolane?
The InChIKey is CCDBBGQBGWTPAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20OS/c1-3-5-6-8-11-12-9-10(13-11)7-4-2/h5-6,10-11H,3-4,7-9H2,1-2H3.
What are the key properties of 2-pent-2-enyl-4-propyl-1,3-oxathiolane?
2-pent-2-enyl-4-propyl-1,3-oxathiolane has a molecular weight of 200.35 g/mol, XLogP of 3.60, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pent-2-enyl-4-propyl-1,3-oxathiolane is sourced from PubChem (CID 175140200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).