C25H36O5 — CID 175141511
5-O-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 1-O-phenyl 2-(3-oxobutyl)pentanedioate (PubChem CID 175141511) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is 5-O-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 1-O-phenyl 2-(3-oxobutyl)pentanedioate.
| Compound Name | 5-O-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 1-O-phenyl 2-(3-oxobutyl)pentanedioate |
|---|---|
| PubChem CID | 175141511 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 5-O-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 1-O-phenyl 2-(3-oxobutyl)pentanedioate |
| SMILES | CC(=O)CCC(CCC(=O)O[C@H]1C[C@@H](C)CC[C@@H]1C(C)C)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C25H36O5/c1-17(2)22-14-10-18(3)16-23(22)30-24(27)15-13-20(12-11-19(4)26)25(28)29-21-8-6-5-7-9-21/h5-9,17-18,20,22-23H,10-16H2,1-4H3/t18-,20?,22+,23-/m0/s1 |
| InChIKey | SXGCKENUNUBYBD-UKXZNWDTSA-N |
| XLogP | 5.36 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|