About methyl 2,2-bis(3-cyclopropyl-4,5-difluorophenyl)acetate
methyl 2,2-bis(3-cyclopropyl-4,5-difluorophenyl)acetate (PubChem CID 175141599) has the molecular formula C21H18F4O2
and a molecular weight of 378.37 g/mol. Its IUPAC name is methyl 2,2-bis(3-cyclopropyl-4,5-difluorophenyl)acetate.
Molecular Properties
| Compound Name | methyl 2,2-bis(3-cyclopropyl-4,5-difluorophenyl)acetate |
| PubChem CID | 175141599 |
| Molecular Formula | C21H18F4O2 |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | methyl 2,2-bis(3-cyclopropyl-4,5-difluorophenyl)acetate |
| SMILES | COC(=O)C(c1cc(F)c(F)c(C2CC2)c1)c1cc(F)c(F)c(C2CC2)c1 |
| InChI | InChI=1S/C21H18F4O2/c1-27-21(26)18(12-6-14(10-2-3-10)19(24)16(22)8-12)13-7-15(11-4-5-11)20(25)17(23)9-13/h6-11,18H,2-5H2,1H3 |
| InChIKey | HAEOKBHYOFRMNE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 2,2-bis(3-cyclopropyl-4,5-difluorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,2-bis(3-cyclopropyl-4,5-difluorophenyl)acetate?
The IUPAC name of methyl 2,2-bis(3-cyclopropyl-4,5-difluorophenyl)acetate (CID 175141599) is methyl 2,2-bis(3-cyclopropyl-4,5-difluorophenyl)acetate.
What is the SMILES notation for methyl 2,2-bis(3-cyclopropyl-4,5-difluorophenyl)acetate?
The canonical SMILES for methyl 2,2-bis(3-cyclopropyl-4,5-difluorophenyl)acetate is COC(=O)C(c1cc(F)c(F)c(C2CC2)c1)c1cc(F)c(F)c(C2CC2)c1.
What is the InChIKey of methyl 2,2-bis(3-cyclopropyl-4,5-difluorophenyl)acetate?
The InChIKey is HAEOKBHYOFRMNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F4O2/c1-27-21(26)18(12-6-14(10-2-3-10)19(24)16(22)8-12)13-7-15(11-4-5-11)20(25)17(23)9-13/h6-11,18H,2-5H2,1H3.
What are the key properties of methyl 2,2-bis(3-cyclopropyl-4,5-difluorophenyl)acetate?
methyl 2,2-bis(3-cyclopropyl-4,5-difluorophenyl)acetate has a molecular weight of 378.37 g/mol, XLogP of 5.30, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-bis(3-cyclopropyl-4,5-difluorophenyl)acetate is sourced from PubChem (CID 175141599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).