C10H8O4 — CID 175141635
3,6-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-4,5-dione (PubChem CID 175141635) has the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. Its IUPAC name is 3,6-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-4,5-dione.
| Compound Name | 3,6-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-4,5-dione |
|---|---|
| PubChem CID | 175141635 |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 3,6-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-4,5-dione |
| SMILES | O=C1OCc2ccc(cc2)COC1=O |
| InChI | InChI=1S/C10H8O4/c11-9-10(12)14-6-8-2-1-7(3-4-8)5-13-9/h1-4H,5-6H2 |
| InChIKey | GVKKRUYTIWABJX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|