(4,4-difluorocyclohexyl)hydrazine;hypochlorous acid

C6H13ClF2N2O — CID 175141698

IUPAC(4,4-difluorocyclohexyl)hydrazine;hypochlorous acid
SMILESNNC1CCC(F)(F)CC1.OCl
InChIInChI=1S/C6H12F2N2.ClHO/c7-6(8)3-1-5(10-9)2-4-6;1-2/h5,10H,1-4,9H2;2H
InChIKeyBAJQPPWKHACPCR-UHFFFAOYSA-N
MW202.63 g/mol
LogP1.16
Rot. Bonds1

About (4,4-difluorocyclohexyl)hydrazine;hypochlorous acid

(4,4-difluorocyclohexyl)hydrazine;hypochlorous acid (PubChem CID 175141698) has the molecular formula C6H13ClF2N2O and a molecular weight of 202.63 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)hydrazine;hypochlorous acid.

Molecular Properties

Compound Name(4,4-difluorocyclohexyl)hydrazine;hypochlorous acid
PubChem CID175141698
Molecular FormulaC6H13ClF2N2O
Molecular Weight202.63 g/mol
Exact Mass202.07
IUPAC Name(4,4-difluorocyclohexyl)hydrazine;hypochlorous acid
SMILESNNC1CCC(F)(F)CC1.OCl
InChIInChI=1S/C6H12F2N2.ClHO/c7-6(8)3-1-5(10-9)2-4-6;1-2/h5,10H,1-4,9H2;2H
InChIKeyBAJQPPWKHACPCR-UHFFFAOYSA-N
XLogP1.16
TPSA58.28 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.63
LogP ≤ 51.16
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (4,4-difluorocyclohexyl)hydrazine;hypochlorous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4,4-difluorocyclohexyl)hydrazine;hypochlorous acid?
The IUPAC name of (4,4-difluorocyclohexyl)hydrazine;hypochlorous acid (CID 175141698) is (4,4-difluorocyclohexyl)hydrazine;hypochlorous acid.
What is the SMILES notation for (4,4-difluorocyclohexyl)hydrazine;hypochlorous acid?
The canonical SMILES for (4,4-difluorocyclohexyl)hydrazine;hypochlorous acid is NNC1CCC(F)(F)CC1.OCl.
What is the InChIKey of (4,4-difluorocyclohexyl)hydrazine;hypochlorous acid?
The InChIKey is BAJQPPWKHACPCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12F2N2.ClHO/c7-6(8)3-1-5(10-9)2-4-6;1-2/h5,10H,1-4,9H2;2H.
What are the key properties of (4,4-difluorocyclohexyl)hydrazine;hypochlorous acid?
(4,4-difluorocyclohexyl)hydrazine;hypochlorous acid has a molecular weight of 202.63 g/mol, XLogP of 1.16, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluorocyclohexyl)hydrazine;hypochlorous acid is sourced from PubChem (CID 175141698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).