C29H28N8O4S — CID 175141833
5,7,11-triamino-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-7-(5-pyrimidin-2-yloxy-2-pyridinyl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175141833) has the molecular formula C29H28N8O4S and a molecular weight of 584.66 g/mol. Its IUPAC name is 5,7,11-triamino-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-7-(5-pyrimidin-2-yloxy-2-pyridinyl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-7-(5-pyrimidin-2-yloxy-2-pyridinyl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175141833 |
| Molecular Formula | C29H28N8O4S |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | 5,7,11-triamino-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-7-(5-pyrimidin-2-yloxy-2-pyridinyl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCC[C@H]1NC(=O)c1sc2c(N)ccc3c2c1C(N)C(=O)C3(N)c1ccc(Oc2ncccn2)cn1 |
| InChI | InChI=1S/C29H28N8O4S/c1-2-20(38)36-17-5-3-6-18(17)37-27(40)25-22-21-15(8-9-16(30)24(21)42-25)29(32,26(39)23(22)31)19-10-7-14(13-35-19)41-28-33-11-4-12-34-28/h2,4,7-13,17-18,23H,1,3,5-6,30-32H2,(H,36,38)(H,37,40)/t17-,18+,23?,29?/m0/s1 |
| InChIKey | MBLZEWUKTQKLKG-NOLHZYOLSA-N |
| XLogP | 2.20 |
| TPSA | 201.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|