C23H18N4O4S — CID 175141976
5,7,11-triamino-6-oxo-7-(4-pyridin-3-yloxyphenyl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid (PubChem CID 175141976) has the molecular formula C23H18N4O4S and a molecular weight of 446.49 g/mol. Its IUPAC name is 5,7,11-triamino-6-oxo-7-(4-pyridin-3-yloxyphenyl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid.
| Compound Name | 5,7,11-triamino-6-oxo-7-(4-pyridin-3-yloxyphenyl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid |
|---|---|
| PubChem CID | 175141976 |
| Molecular Formula | C23H18N4O4S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 5,7,11-triamino-6-oxo-7-(4-pyridin-3-yloxyphenyl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid |
| SMILES | Nc1ccc2c3c(c(C(=O)O)sc13)C(N)C(=O)C2(N)c1ccc(Oc2cccnc2)cc1 |
| InChI | InChI=1S/C23H18N4O4S/c24-15-8-7-14-16-17(20(22(29)30)32-19(15)16)18(25)21(28)23(14,26)11-3-5-12(6-4-11)31-13-2-1-9-27-10-13/h1-10,18H,24-26H2,(H,29,30) |
| InChIKey | OTWHHNREPMCNAX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 154.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|