About 2-(bromomethyl)octanoic acid
2-(bromomethyl)octanoic acid (PubChem CID 175142775) has the molecular formula C9H17BrO2
and a molecular weight of 237.14 g/mol. Its IUPAC name is 2-(bromomethyl)octanoic acid.
Molecular Properties
| Compound Name | 2-(bromomethyl)octanoic acid |
| PubChem CID | 175142775 |
| Molecular Formula | C9H17BrO2 |
| Molecular Weight | 237.14 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2-(bromomethyl)octanoic acid |
| SMILES | CCCCCCC(CBr)C(=O)O |
| InChI | InChI=1S/C9H17BrO2/c1-2-3-4-5-6-8(7-10)9(11)12/h8H,2-7H2,1H3,(H,11,12) |
| InChIKey | YQGBZCCGEPALOS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.14 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)octanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)octanoic acid?
The IUPAC name of 2-(bromomethyl)octanoic acid (CID 175142775) is 2-(bromomethyl)octanoic acid.
What is the SMILES notation for 2-(bromomethyl)octanoic acid?
The canonical SMILES for 2-(bromomethyl)octanoic acid is CCCCCCC(CBr)C(=O)O.
What is the InChIKey of 2-(bromomethyl)octanoic acid?
The InChIKey is YQGBZCCGEPALOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17BrO2/c1-2-3-4-5-6-8(7-10)9(11)12/h8H,2-7H2,1H3,(H,11,12).
What are the key properties of 2-(bromomethyl)octanoic acid?
2-(bromomethyl)octanoic acid has a molecular weight of 237.14 g/mol, XLogP of 3.05, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)octanoic acid is sourced from PubChem (CID 175142775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).