C10H16O10S — CID 175142856
2-[2-oxo-2-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxyethyl]sulfanylacetic acid (PubChem CID 175142856) has the molecular formula C10H16O10S and a molecular weight of 328.30 g/mol. Its IUPAC name is 2-[2-oxo-2-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxyethyl]sulfanylacetic acid.
| Compound Name | 2-[2-oxo-2-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxyethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 175142856 |
| Molecular Formula | C10H16O10S |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-[2-oxo-2-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxyethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)OC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H16O10S/c11-1-4(12)7(16)8(17)9(18)10(19)20-6(15)3-21-2-5(13)14/h4,7-9,11-12,16-18H,1-3H2,(H,13,14)/t4-,7-,8+,9-/m1/s1 |
| InChIKey | DFMHIXFQGFGQIT-LPJZALPJSA-N |
| XLogP | -3.69 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|