About prop-2-ynyl 3-[4-amino-3-carbamoyl-5-(4-sulfamoylphenyl)phenyl]-4-hydroxybenzoate
prop-2-ynyl 3-[4-amino-3-carbamoyl-5-(4-sulfamoylphenyl)phenyl]-4-hydroxybenzoate (PubChem CID 175144276) has the molecular formula C23H19N3O6S
and a molecular weight of 465.49 g/mol. Its IUPAC name is prop-2-ynyl 3-[4-amino-3-carbamoyl-5-(4-sulfamoylphenyl)phenyl]-4-hydroxybenzoate.
Molecular Properties
| Compound Name | prop-2-ynyl 3-[4-amino-3-carbamoyl-5-(4-sulfamoylphenyl)phenyl]-4-hydroxybenzoate |
| PubChem CID | 175144276 |
| Molecular Formula | C23H19N3O6S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | prop-2-ynyl 3-[4-amino-3-carbamoyl-5-(4-sulfamoylphenyl)phenyl]-4-hydroxybenzoate |
| SMILES | C#CCOC(=O)c1ccc(O)c(-c2cc(C(N)=O)c(N)c(-c3ccc(S(N)(=O)=O)cc3)c2)c1 |
| InChI | InChI=1S/C23H19N3O6S/c1-2-9-32-23(29)14-5-8-20(27)17(10-14)15-11-18(21(24)19(12-15)22(25)28)13-3-6-16(7-4-13)33(26,30)31/h1,3-8,10-12,27H,9,24H2,(H2,25,28)(H2,26,30,31) |
| InChIKey | YPJOSUDBIJHEDH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 175.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 3-[4-amino-3-carbamoyl-5-(4-sulfamoylphenyl)phenyl]-4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 3-[4-amino-3-carbamoyl-5-(4-sulfamoylphenyl)phenyl]-4-hydroxybenzoate?
The IUPAC name of prop-2-ynyl 3-[4-amino-3-carbamoyl-5-(4-sulfamoylphenyl)phenyl]-4-hydroxybenzoate (CID 175144276) is prop-2-ynyl 3-[4-amino-3-carbamoyl-5-(4-sulfamoylphenyl)phenyl]-4-hydroxybenzoate.
What is the SMILES notation for prop-2-ynyl 3-[4-amino-3-carbamoyl-5-(4-sulfamoylphenyl)phenyl]-4-hydroxybenzoate?
The canonical SMILES for prop-2-ynyl 3-[4-amino-3-carbamoyl-5-(4-sulfamoylphenyl)phenyl]-4-hydroxybenzoate is C#CCOC(=O)c1ccc(O)c(-c2cc(C(N)=O)c(N)c(-c3ccc(S(N)(=O)=O)cc3)c2)c1.
What is the InChIKey of prop-2-ynyl 3-[4-amino-3-carbamoyl-5-(4-sulfamoylphenyl)phenyl]-4-hydroxybenzoate?
The InChIKey is YPJOSUDBIJHEDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N3O6S/c1-2-9-32-23(29)14-5-8-20(27)17(10-14)15-11-18(21(24)19(12-15)22(25)28)13-3-6-16(7-4-13)33(26,30)31/h1,3-8,10-12,27H,9,24H2,(H2,25,28)(H2,26,30,31).
What are the key properties of prop-2-ynyl 3-[4-amino-3-carbamoyl-5-(4-sulfamoylphenyl)phenyl]-4-hydroxybenzoate?
prop-2-ynyl 3-[4-amino-3-carbamoyl-5-(4-sulfamoylphenyl)phenyl]-4-hydroxybenzoate has a molecular weight of 465.49 g/mol, XLogP of 1.84, 6 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 3-[4-amino-3-carbamoyl-5-(4-sulfamoylphenyl)phenyl]-4-hydroxybenzoate is sourced from PubChem (CID 175144276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).