About tetrabutylazanium;triazinane-4,5,6-trithione
tetrabutylazanium;triazinane-4,5,6-trithione (PubChem CID 175144598) has the molecular formula C19H39N4S3+
and a molecular weight of 419.75 g/mol. Its IUPAC name is tetrabutylazanium;triazinane-4,5,6-trithione.
Molecular Properties
| Compound Name | tetrabutylazanium;triazinane-4,5,6-trithione |
| PubChem CID | 175144598 |
| Molecular Formula | C19H39N4S3+ |
| Molecular Weight | 419.75 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | tetrabutylazanium;triazinane-4,5,6-trithione |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.S=c1[nH][nH][nH]c(=S)c1=S |
| InChI | InChI=1S/C16H36N.C3H3N3S3/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-1-2(8)4-6-5-3(1)9/h5-16H2,1-4H3;(H,6,7)(H2,4,5,8,9)/q+1; |
| InChIKey | ODCXSRIWNMQRQZ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 47.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.75 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylazanium;triazinane-4,5,6-trithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylazanium;triazinane-4,5,6-trithione?
The IUPAC name of tetrabutylazanium;triazinane-4,5,6-trithione (CID 175144598) is tetrabutylazanium;triazinane-4,5,6-trithione.
What is the SMILES notation for tetrabutylazanium;triazinane-4,5,6-trithione?
The canonical SMILES for tetrabutylazanium;triazinane-4,5,6-trithione is CCCC[N+](CCCC)(CCCC)CCCC.S=c1[nH][nH][nH]c(=S)c1=S.
What is the InChIKey of tetrabutylazanium;triazinane-4,5,6-trithione?
The InChIKey is ODCXSRIWNMQRQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.C3H3N3S3/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-1-2(8)4-6-5-3(1)9/h5-16H2,1-4H3;(H,6,7)(H2,4,5,8,9)/q+1;.
What are the key properties of tetrabutylazanium;triazinane-4,5,6-trithione?
tetrabutylazanium;triazinane-4,5,6-trithione has a molecular weight of 419.75 g/mol, XLogP of 6.86, 12 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylazanium;triazinane-4,5,6-trithione is sourced from PubChem (CID 175144598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).