C22H25IN6O2 — CID 175144770
N-ethyl-1-[4-[(3-iodoimidazo[1,2-a]pyrazin-8-yl)amino]-2-methylbenzoyl]piperidine-4-carboxamide (PubChem CID 175144770) has the molecular formula C22H25IN6O2 and a molecular weight of 532.39 g/mol. Its IUPAC name is N-ethyl-1-[4-[(3-iodoimidazo[1,2-a]pyrazin-8-yl)amino]-2-methylbenzoyl]piperidine-4-carboxamide.
| Compound Name | N-ethyl-1-[4-[(3-iodoimidazo[1,2-a]pyrazin-8-yl)amino]-2-methylbenzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 175144770 |
| Molecular Formula | C22H25IN6O2 |
| Molecular Weight | 532.39 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | N-ethyl-1-[4-[(3-iodoimidazo[1,2-a]pyrazin-8-yl)amino]-2-methylbenzoyl]piperidine-4-carboxamide |
| SMILES | CCNC(=O)C1CCN(C(=O)c2ccc(Nc3nccn4c(I)cnc34)cc2C)CC1 |
| InChI | InChI=1S/C22H25IN6O2/c1-3-24-21(30)15-6-9-28(10-7-15)22(31)17-5-4-16(12-14(17)2)27-19-20-26-13-18(23)29(20)11-8-25-19/h4-5,8,11-13,15H,3,6-7,9-10H2,1-2H3,(H,24,30)(H,25,27) |
| InChIKey | JUYLYYPJRZHNDS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|