C15H16ClN3O3 — CID 175145574
2-chloro-N-[1-oxo-2-(6-oxopiperidin-3-yl)-3H-isoindol-4-yl]acetamide (PubChem CID 175145574) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is 2-chloro-N-[1-oxo-2-(6-oxopiperidin-3-yl)-3H-isoindol-4-yl]acetamide.
| Compound Name | 2-chloro-N-[1-oxo-2-(6-oxopiperidin-3-yl)-3H-isoindol-4-yl]acetamide |
|---|---|
| PubChem CID | 175145574 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-chloro-N-[1-oxo-2-(6-oxopiperidin-3-yl)-3H-isoindol-4-yl]acetamide |
| SMILES | O=C1CCC(N2Cc3c(NC(=O)CCl)cccc3C2=O)CN1 |
| InChI | InChI=1S/C15H16ClN3O3/c16-6-14(21)18-12-3-1-2-10-11(12)8-19(15(10)22)9-4-5-13(20)17-7-9/h1-3,9H,4-8H2,(H,17,20)(H,18,21) |
| InChIKey | PHPVVDBAZYABEM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|