C16H27BO4 — CID 175145575
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl] butanoate (PubChem CID 175145575) has the molecular formula C16H27BO4 and a molecular weight of 294.20 g/mol. Its IUPAC name is [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl] butanoate.
| Compound Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl] butanoate |
|---|---|
| PubChem CID | 175145575 |
| Molecular Formula | C16H27BO4 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl] butanoate |
| SMILES | CCCC(=O)OC1CC=C(B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C16H27BO4/c1-6-7-14(18)19-13-10-8-12(9-11-13)17-20-15(2,3)16(4,5)21-17/h8,13H,6-7,9-11H2,1-5H3 |
| InChIKey | PEKZKVQGOIRNPV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|