C8H21LiOSi2 — CID 175145589
lithium;hydride;2,2,3,3,6-pentamethyloxadisilinane (PubChem CID 175145589) has the molecular formula C8H21LiOSi2 and a molecular weight of 196.37 g/mol. Its IUPAC name is lithium;hydride;2,2,3,3,6-pentamethyloxadisilinane.
| Compound Name | lithium;hydride;2,2,3,3,6-pentamethyloxadisilinane |
|---|---|
| PubChem CID | 175145589 |
| Molecular Formula | C8H21LiOSi2 |
| Molecular Weight | 196.37 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | lithium;hydride;2,2,3,3,6-pentamethyloxadisilinane |
| SMILES | CC1CC[Si](C)(C)[Si](C)(C)O1.[H-].[Li+] |
| InChI | InChI=1S/C8H20OSi2.Li.H/c1-8-6-7-10(2,3)11(4,5)9-8;;/h8H,6-7H2,1-5H3;;/q;+1;-1 |
| InChIKey | AWGCMNLAKZCOLH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.37 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|