C30H29N7O4S — CID 175146203
5,7,11-triamino-6-oxo-7-(2-phenoxypyrimidin-5-yl)-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175146203) has the molecular formula C30H29N7O4S and a molecular weight of 583.67 g/mol. Its IUPAC name is 5,7,11-triamino-6-oxo-7-(2-phenoxypyrimidin-5-yl)-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-6-oxo-7-(2-phenoxypyrimidin-5-yl)-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175146203 |
| Molecular Formula | C30H29N7O4S |
| Molecular Weight | 583.67 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | 5,7,11-triamino-6-oxo-7-(2-phenoxypyrimidin-5-yl)-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCC[C@H]1NC(=O)c1sc2c(N)ccc3c2c1C(N)C(=O)C3(N)c1cnc(Oc2ccccc2)nc1 |
| InChI | InChI=1S/C30H29N7O4S/c1-2-21(38)36-19-9-6-10-20(19)37-28(40)26-23-22-17(11-12-18(31)25(22)42-26)30(33,27(39)24(23)32)15-13-34-29(35-14-15)41-16-7-4-3-5-8-16/h2-5,7-8,11-14,19-20,24H,1,6,9-10,31-33H2,(H,36,38)(H,37,40)/t19-,20+,24?,30?/m0/s1 |
| InChIKey | JPAYJVYOTPMWRM-UHYZMHTGSA-N |
| XLogP | 2.80 |
| TPSA | 188.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.67 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|