About 2-aminoethyl 3-piperazin-1-ylpropane-1-sulfonate
2-aminoethyl 3-piperazin-1-ylpropane-1-sulfonate (PubChem CID 175146380) has the molecular formula C9H21N3O3S
and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-aminoethyl 3-piperazin-1-ylpropane-1-sulfonate.
Molecular Properties
| Compound Name | 2-aminoethyl 3-piperazin-1-ylpropane-1-sulfonate |
| PubChem CID | 175146380 |
| Molecular Formula | C9H21N3O3S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-aminoethyl 3-piperazin-1-ylpropane-1-sulfonate |
| SMILES | NCCOS(=O)(=O)CCCN1CCNCC1 |
| InChI | InChI=1S/C9H21N3O3S/c10-2-8-15-16(13,14)9-1-5-12-6-3-11-4-7-12/h11H,1-10H2 |
| InChIKey | PJRBNHYOJJJXKM-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl 3-piperazin-1-ylpropane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl 3-piperazin-1-ylpropane-1-sulfonate?
The IUPAC name of 2-aminoethyl 3-piperazin-1-ylpropane-1-sulfonate (CID 175146380) is 2-aminoethyl 3-piperazin-1-ylpropane-1-sulfonate.
What is the SMILES notation for 2-aminoethyl 3-piperazin-1-ylpropane-1-sulfonate?
The canonical SMILES for 2-aminoethyl 3-piperazin-1-ylpropane-1-sulfonate is NCCOS(=O)(=O)CCCN1CCNCC1.
What is the InChIKey of 2-aminoethyl 3-piperazin-1-ylpropane-1-sulfonate?
The InChIKey is PJRBNHYOJJJXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3O3S/c10-2-8-15-16(13,14)9-1-5-12-6-3-11-4-7-12/h11H,1-10H2.
What are the key properties of 2-aminoethyl 3-piperazin-1-ylpropane-1-sulfonate?
2-aminoethyl 3-piperazin-1-ylpropane-1-sulfonate has a molecular weight of 251.35 g/mol, XLogP of -1.41, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl 3-piperazin-1-ylpropane-1-sulfonate is sourced from PubChem (CID 175146380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).