About (8-bromoquinolin-3-yl) carbamate
(8-bromoquinolin-3-yl) carbamate (PubChem CID 175146907) has the molecular formula C10H7BrN2O2
and a molecular weight of 267.08 g/mol. Its IUPAC name is (8-bromoquinolin-3-yl) carbamate.
Molecular Properties
| Compound Name | (8-bromoquinolin-3-yl) carbamate |
| PubChem CID | 175146907 |
| Molecular Formula | C10H7BrN2O2 |
| Molecular Weight | 267.08 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | (8-bromoquinolin-3-yl) carbamate |
| SMILES | NC(=O)Oc1cnc2c(Br)cccc2c1 |
| InChI | InChI=1S/C10H7BrN2O2/c11-8-3-1-2-6-4-7(15-10(12)14)5-13-9(6)8/h1-5H,(H2,12,14) |
| InChIKey | YDSUKDFSTBXJMZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.08 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (8-bromoquinolin-3-yl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-bromoquinolin-3-yl) carbamate?
The IUPAC name of (8-bromoquinolin-3-yl) carbamate (CID 175146907) is (8-bromoquinolin-3-yl) carbamate.
What is the SMILES notation for (8-bromoquinolin-3-yl) carbamate?
The canonical SMILES for (8-bromoquinolin-3-yl) carbamate is NC(=O)Oc1cnc2c(Br)cccc2c1.
What is the InChIKey of (8-bromoquinolin-3-yl) carbamate?
The InChIKey is YDSUKDFSTBXJMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrN2O2/c11-8-3-1-2-6-4-7(15-10(12)14)5-13-9(6)8/h1-5H,(H2,12,14).
What are the key properties of (8-bromoquinolin-3-yl) carbamate?
(8-bromoquinolin-3-yl) carbamate has a molecular weight of 267.08 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8-bromoquinolin-3-yl) carbamate is sourced from PubChem (CID 175146907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).