About 1-[(4,4-difluorocyclohexyl)methyl]-3-(difluoromethoxymethyl)piperazine;hydrochloride
1-[(4,4-difluorocyclohexyl)methyl]-3-(difluoromethoxymethyl)piperazine;hydrochloride (PubChem CID 175147385) has the molecular formula C13H23ClF4N2O
and a molecular weight of 334.79 g/mol. Its IUPAC name is 1-[(4,4-difluorocyclohexyl)methyl]-3-(difluoromethoxymethyl)piperazine;hydrochloride.
Molecular Properties
| Compound Name | 1-[(4,4-difluorocyclohexyl)methyl]-3-(difluoromethoxymethyl)piperazine;hydrochloride |
| PubChem CID | 175147385 |
| Molecular Formula | C13H23ClF4N2O |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-[(4,4-difluorocyclohexyl)methyl]-3-(difluoromethoxymethyl)piperazine;hydrochloride |
| SMILES | Cl.FC(F)OCC1CN(CC2CCC(F)(F)CC2)CCN1 |
| InChI | InChI=1S/C13H22F4N2O.ClH/c14-12(15)20-9-11-8-19(6-5-18-11)7-10-1-3-13(16,17)4-2-10;/h10-12,18H,1-9H2;1H |
| InChIKey | HILXZAFMUJNXJS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4,4-difluorocyclohexyl)methyl]-3-(difluoromethoxymethyl)piperazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4,4-difluorocyclohexyl)methyl]-3-(difluoromethoxymethyl)piperazine;hydrochloride?
The IUPAC name of 1-[(4,4-difluorocyclohexyl)methyl]-3-(difluoromethoxymethyl)piperazine;hydrochloride (CID 175147385) is 1-[(4,4-difluorocyclohexyl)methyl]-3-(difluoromethoxymethyl)piperazine;hydrochloride.
What is the SMILES notation for 1-[(4,4-difluorocyclohexyl)methyl]-3-(difluoromethoxymethyl)piperazine;hydrochloride?
The canonical SMILES for 1-[(4,4-difluorocyclohexyl)methyl]-3-(difluoromethoxymethyl)piperazine;hydrochloride is Cl.FC(F)OCC1CN(CC2CCC(F)(F)CC2)CCN1.
What is the InChIKey of 1-[(4,4-difluorocyclohexyl)methyl]-3-(difluoromethoxymethyl)piperazine;hydrochloride?
The InChIKey is HILXZAFMUJNXJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F4N2O.ClH/c14-12(15)20-9-11-8-19(6-5-18-11)7-10-1-3-13(16,17)4-2-10;/h10-12,18H,1-9H2;1H.
What are the key properties of 1-[(4,4-difluorocyclohexyl)methyl]-3-(difluoromethoxymethyl)piperazine;hydrochloride?
1-[(4,4-difluorocyclohexyl)methyl]-3-(difluoromethoxymethyl)piperazine;hydrochloride has a molecular weight of 334.79 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4,4-difluorocyclohexyl)methyl]-3-(difluoromethoxymethyl)piperazine;hydrochloride is sourced from PubChem (CID 175147385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).