About 4,5-dihydro-1,3-oxazole;naphthalen-1-amine
4,5-dihydro-1,3-oxazole;naphthalen-1-amine (PubChem CID 175147441) has the molecular formula C13H14N2O
and a molecular weight of 214.27 g/mol. Its IUPAC name is 4,5-dihydro-1,3-oxazole;naphthalen-1-amine.
Molecular Properties
| Compound Name | 4,5-dihydro-1,3-oxazole;naphthalen-1-amine |
| PubChem CID | 175147441 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 4,5-dihydro-1,3-oxazole;naphthalen-1-amine |
| SMILES | C1=NCCO1.Nc1cccc2ccccc12 |
| InChI | InChI=1S/C10H9N.C3H5NO/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-2-5-3-4-1/h1-7H,11H2;3H,1-2H2 |
| InChIKey | HRLNXUNPKLDBNM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydro-1,3-oxazole;naphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1,3-oxazole;naphthalen-1-amine?
The IUPAC name of 4,5-dihydro-1,3-oxazole;naphthalen-1-amine (CID 175147441) is 4,5-dihydro-1,3-oxazole;naphthalen-1-amine.
What is the SMILES notation for 4,5-dihydro-1,3-oxazole;naphthalen-1-amine?
The canonical SMILES for 4,5-dihydro-1,3-oxazole;naphthalen-1-amine is C1=NCCO1.Nc1cccc2ccccc12.
What is the InChIKey of 4,5-dihydro-1,3-oxazole;naphthalen-1-amine?
The InChIKey is HRLNXUNPKLDBNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.C3H5NO/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-2-5-3-4-1/h1-7H,11H2;3H,1-2H2.
What are the key properties of 4,5-dihydro-1,3-oxazole;naphthalen-1-amine?
4,5-dihydro-1,3-oxazole;naphthalen-1-amine has a molecular weight of 214.27 g/mol, XLogP of 2.47, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1,3-oxazole;naphthalen-1-amine is sourced from PubChem (CID 175147441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).