C44H58N14O4 — CID 175147818
methyl 2,4-bis[2-[[1-[1-(tert-butylcarbamoyl)piperidin-4-yl]pyrazol-4-yl]amino]-5-methylpyrimidin-4-yl]benzoate (PubChem CID 175147818) has the molecular formula C44H58N14O4 and a molecular weight of 847.04 g/mol. Its IUPAC name is methyl 2,4-bis[2-[[1-[1-(tert-butylcarbamoyl)piperidin-4-yl]pyrazol-4-yl]amino]-5-methylpyrimidin-4-yl]benzoate.
| Compound Name | methyl 2,4-bis[2-[[1-[1-(tert-butylcarbamoyl)piperidin-4-yl]pyrazol-4-yl]amino]-5-methylpyrimidin-4-yl]benzoate |
|---|---|
| PubChem CID | 175147818 |
| Molecular Formula | C44H58N14O4 |
| Molecular Weight | 847.04 g/mol |
| Exact Mass | 846.48 |
| IUPAC Name | methyl 2,4-bis[2-[[1-[1-(tert-butylcarbamoyl)piperidin-4-yl]pyrazol-4-yl]amino]-5-methylpyrimidin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2nc(Nc3cnn(C4CCN(C(=O)NC(C)(C)C)CC4)c3)ncc2C)cc1-c1nc(Nc2cnn(C3CCN(C(=O)NC(C)(C)C)CC3)c2)ncc1C |
| InChI | InChI=1S/C44H58N14O4/c1-27-21-45-39(49-30-23-47-57(25-30)32-12-16-55(17-13-32)41(60)53-43(3,4)5)51-36(27)29-10-11-34(38(59)62-9)35(20-29)37-28(2)22-46-40(52-37)50-31-24-48-58(26-31)33-14-18-56(19-15-33)42(61)54-44(6,7)8/h10-11,20-26,32-33H,12-19H2,1-9H3,(H,53,60)(H,54,61)(H,45,49,51)(H,46,50,52) |
| InChIKey | PFGFUYIICNWMLD-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 202.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.04 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |