About 3-methoxytetradec-5-ene
3-methoxytetradec-5-ene (PubChem CID 175147836) has the molecular formula C15H30O
and a molecular weight of 226.40 g/mol. Its IUPAC name is 3-methoxytetradec-5-ene.
Molecular Properties
| Compound Name | 3-methoxytetradec-5-ene |
| PubChem CID | 175147836 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 3-methoxytetradec-5-ene |
| SMILES | CCCCCCCCC=CCC(CC)OC |
| InChI | InChI=1S/C15H30O/c1-4-6-7-8-9-10-11-12-13-14-15(5-2)16-3/h12-13,15H,4-11,14H2,1-3H3 |
| InChIKey | ZDWLSPLPZCXDCK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxytetradec-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxytetradec-5-ene?
The IUPAC name of 3-methoxytetradec-5-ene (CID 175147836) is 3-methoxytetradec-5-ene.
What is the SMILES notation for 3-methoxytetradec-5-ene?
The canonical SMILES for 3-methoxytetradec-5-ene is CCCCCCCCC=CCC(CC)OC.
What is the InChIKey of 3-methoxytetradec-5-ene?
The InChIKey is ZDWLSPLPZCXDCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O/c1-4-6-7-8-9-10-11-12-13-14-15(5-2)16-3/h12-13,15H,4-11,14H2,1-3H3.
What are the key properties of 3-methoxytetradec-5-ene?
3-methoxytetradec-5-ene has a molecular weight of 226.40 g/mol, XLogP of 5.11, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxytetradec-5-ene is sourced from PubChem (CID 175147836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).