C10H15F5O6 — CID 175147916
3-[1,1,2,2,2-pentakis(fluoromethoxy)ethoxy]prop-1-ene (PubChem CID 175147916) has the molecular formula C10H15F5O6 and a molecular weight of 326.21 g/mol. Its IUPAC name is 3-[1,1,2,2,2-pentakis(fluoromethoxy)ethoxy]prop-1-ene.
| Compound Name | 3-[1,1,2,2,2-pentakis(fluoromethoxy)ethoxy]prop-1-ene |
|---|---|
| PubChem CID | 175147916 |
| Molecular Formula | C10H15F5O6 |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 3-[1,1,2,2,2-pentakis(fluoromethoxy)ethoxy]prop-1-ene |
| SMILES | C=CCOC(OCF)(OCF)C(OCF)(OCF)OCF |
| InChI | InChI=1S/C10H15F5O6/c1-2-3-16-9(17-4-11,18-5-12)10(19-6-13,20-7-14)21-8-15/h2H,1,3-8H2 |
| InChIKey | DZAAEJCWCLXXAN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|