C18H17N7O10 — CID 175148271
2-amino-3-(1H-imidazol-5-yl)propanoic acid;bis(1,3-dinitrobenzene) (PubChem CID 175148271) has the molecular formula C18H17N7O10 and a molecular weight of 491.37 g/mol. Its IUPAC name is 2-amino-3-(1H-imidazol-5-yl)propanoic acid;bis(1,3-dinitrobenzene).
| Compound Name | 2-amino-3-(1H-imidazol-5-yl)propanoic acid;bis(1,3-dinitrobenzene) |
|---|---|
| PubChem CID | 175148271 |
| Molecular Formula | C18H17N7O10 |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 2-amino-3-(1H-imidazol-5-yl)propanoic acid;bis(1,3-dinitrobenzene) |
| SMILES | NC(Cc1cnc[nH]1)C(=O)O.O=[N+]([O-])c1cccc([N+](=O)[O-])c1.O=[N+]([O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H9N3O2.2C6H4N2O4/c7-5(6(10)11)1-4-2-8-3-9-4;2*9-7(10)5-2-1-3-6(4-5)8(11)12/h2-3,5H,1,7H2,(H,8,9)(H,10,11);2*1-4H |
| InChIKey | UPXDSVSBVQQSPT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 264.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|