C25H34O7 — CID 175148348
3-(2-nonoxycarbonylcyclohexanecarbonyl)oxycarbonylbenzoic acid (PubChem CID 175148348) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is 3-(2-nonoxycarbonylcyclohexanecarbonyl)oxycarbonylbenzoic acid.
| Compound Name | 3-(2-nonoxycarbonylcyclohexanecarbonyl)oxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 175148348 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 3-(2-nonoxycarbonylcyclohexanecarbonyl)oxycarbonylbenzoic acid |
| SMILES | CCCCCCCCCOC(=O)C1CCCCC1C(=O)OC(=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H34O7/c1-2-3-4-5-6-7-10-16-31-24(29)20-14-8-9-15-21(20)25(30)32-23(28)19-13-11-12-18(17-19)22(26)27/h11-13,17,20-21H,2-10,14-16H2,1H3,(H,26,27) |
| InChIKey | JZEFITLJQJRQAB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|