C25H22N8O4S — CID 175149441
1-[4-[4-cyano-5-morpholin-4-yl-2-(1H-1,2,4-triazol-5-yl)thiophen-3-yl]phenyl]-3-[(E)-(2,4-dihydroxyphenyl)methylideneamino]urea (PubChem CID 175149441) has the molecular formula C25H22N8O4S and a molecular weight of 530.57 g/mol. Its IUPAC name is 1-[4-[4-cyano-5-morpholin-4-yl-2-(1H-1,2,4-triazol-5-yl)thiophen-3-yl]phenyl]-3-[(E)-(2,4-dihydroxyphenyl)methylideneamino]urea.
| Compound Name | 1-[4-[4-cyano-5-morpholin-4-yl-2-(1H-1,2,4-triazol-5-yl)thiophen-3-yl]phenyl]-3-[(E)-(2,4-dihydroxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 175149441 |
| Molecular Formula | C25H22N8O4S |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 1-[4-[4-cyano-5-morpholin-4-yl-2-(1H-1,2,4-triazol-5-yl)thiophen-3-yl]phenyl]-3-[(E)-(2,4-dihydroxyphenyl)methylideneamino]urea |
| SMILES | N#Cc1c(N2CCOCC2)sc(-c2ncn[nH]2)c1-c1ccc(NC(=O)N/N=C/c2ccc(O)cc2O)cc1 |
| InChI | InChI=1S/C25H22N8O4S/c26-12-19-21(22(23-27-14-29-31-23)38-24(19)33-7-9-37-10-8-33)15-1-4-17(5-2-15)30-25(36)32-28-13-16-3-6-18(34)11-20(16)35/h1-6,11,13-14,34-35H,7-10H2,(H,27,29,31)(H2,30,32,36)/b28-13+ |
| InChIKey | GUDCIRHHJGYSEN-XODNFHPESA-N |
| XLogP | 3.48 |
| TPSA | 171.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|