About 3-[(2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)piperidine-1-carbonyl]pyrrolidine-1-carboxylic acid
3-[(2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)piperidine-1-carbonyl]pyrrolidine-1-carboxylic acid (PubChem CID 175150570) has the molecular formula C13H19F3N2O4
and a molecular weight of 324.30 g/mol. Its IUPAC name is 3-[(2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)piperidine-1-carbonyl]pyrrolidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)piperidine-1-carbonyl]pyrrolidine-1-carboxylic acid |
| PubChem CID | 175150570 |
| Molecular Formula | C13H19F3N2O4 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 3-[(2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)piperidine-1-carbonyl]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(C(=O)N2CC[C@H](C(F)(F)F)C[C@H]2CO)C1 |
| InChI | InChI=1S/C13H19F3N2O4/c14-13(15,16)9-2-4-18(10(5-9)7-19)11(20)8-1-3-17(6-8)12(21)22/h8-10,19H,1-7H2,(H,21,22)/t8?,9-,10-/m0/s1 |
| InChIKey | OXUUEDZAGBGYEW-AGROOBSYSA-N |
| XLogP | 1.15 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)piperidine-1-carbonyl]pyrrolidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)piperidine-1-carbonyl]pyrrolidine-1-carboxylic acid?
The IUPAC name of 3-[(2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)piperidine-1-carbonyl]pyrrolidine-1-carboxylic acid (CID 175150570) is 3-[(2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)piperidine-1-carbonyl]pyrrolidine-1-carboxylic acid.
What is the SMILES notation for 3-[(2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)piperidine-1-carbonyl]pyrrolidine-1-carboxylic acid?
The canonical SMILES for 3-[(2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)piperidine-1-carbonyl]pyrrolidine-1-carboxylic acid is O=C(O)N1CCC(C(=O)N2CC[C@H](C(F)(F)F)C[C@H]2CO)C1.
What is the InChIKey of 3-[(2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)piperidine-1-carbonyl]pyrrolidine-1-carboxylic acid?
The InChIKey is OXUUEDZAGBGYEW-AGROOBSYSA-N. The full InChI is InChI=1S/C13H19F3N2O4/c14-13(15,16)9-2-4-18(10(5-9)7-19)11(20)8-1-3-17(6-8)12(21)22/h8-10,19H,1-7H2,(H,21,22)/t8?,9-,10-/m0/s1.
What are the key properties of 3-[(2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)piperidine-1-carbonyl]pyrrolidine-1-carboxylic acid?
3-[(2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)piperidine-1-carbonyl]pyrrolidine-1-carboxylic acid has a molecular weight of 324.30 g/mol, XLogP of 1.15, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S,4S)-2-(hydroxymethyl)-4-(trifluoromethyl)piperidine-1-carbonyl]pyrrolidine-1-carboxylic acid is sourced from PubChem (CID 175150570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).