About 2-[4-(3,4,5-trimethylphenyl)cyclohexylidene]ethylsilane
2-[4-(3,4,5-trimethylphenyl)cyclohexylidene]ethylsilane (PubChem CID 175150765) has the molecular formula C17H26Si
and a molecular weight of 258.48 g/mol. Its IUPAC name is 2-[4-(3,4,5-trimethylphenyl)cyclohexylidene]ethylsilane.
Molecular Properties
| Compound Name | 2-[4-(3,4,5-trimethylphenyl)cyclohexylidene]ethylsilane |
| PubChem CID | 175150765 |
| Molecular Formula | C17H26Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-[4-(3,4,5-trimethylphenyl)cyclohexylidene]ethylsilane |
| SMILES | Cc1cc(C2CCC(=CC[SiH3])CC2)cc(C)c1C |
| InChI | InChI=1S/C17H26Si/c1-12-10-17(11-13(2)14(12)3)16-6-4-15(5-7-16)8-9-18/h8,10-11,16H,4-7,9H2,1-3,18H3/b15-8- |
| InChIKey | BWQRTQVZLLXLAX-NVNXTCNLSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(3,4,5-trimethylphenyl)cyclohexylidene]ethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,4,5-trimethylphenyl)cyclohexylidene]ethylsilane?
The IUPAC name of 2-[4-(3,4,5-trimethylphenyl)cyclohexylidene]ethylsilane (CID 175150765) is 2-[4-(3,4,5-trimethylphenyl)cyclohexylidene]ethylsilane.
What is the SMILES notation for 2-[4-(3,4,5-trimethylphenyl)cyclohexylidene]ethylsilane?
The canonical SMILES for 2-[4-(3,4,5-trimethylphenyl)cyclohexylidene]ethylsilane is Cc1cc(C2CCC(=CC[SiH3])CC2)cc(C)c1C.
What is the InChIKey of 2-[4-(3,4,5-trimethylphenyl)cyclohexylidene]ethylsilane?
The InChIKey is BWQRTQVZLLXLAX-NVNXTCNLSA-N. The full InChI is InChI=1S/C17H26Si/c1-12-10-17(11-13(2)14(12)3)16-6-4-15(5-7-16)8-9-18/h8,10-11,16H,4-7,9H2,1-3,18H3/b15-8-.
What are the key properties of 2-[4-(3,4,5-trimethylphenyl)cyclohexylidene]ethylsilane?
2-[4-(3,4,5-trimethylphenyl)cyclohexylidene]ethylsilane has a molecular weight of 258.48 g/mol, XLogP of 3.98, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,4,5-trimethylphenyl)cyclohexylidene]ethylsilane is sourced from PubChem (CID 175150765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).