C8H13F9NO+ — CID 175151132
1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-ol;tetramethylazanium (PubChem CID 175151132) has the molecular formula C8H13F9NO+ and a molecular weight of 310.18 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-ol;tetramethylazanium.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-ol;tetramethylazanium |
|---|---|
| PubChem CID | 175151132 |
| Molecular Formula | C8H13F9NO+ |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-ol;tetramethylazanium |
| SMILES | C[N+](C)(C)C.OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4HF9O.C4H12N/c5-2(6,7)1(14,3(8,9)10)4(11,12)13;1-5(2,3)4/h14H;1-4H3/q;+1 |
| InChIKey | IIMRBPHONOGLQW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|