About propan-2-yl 6-ethoxy-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylate
propan-2-yl 6-ethoxy-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 175151411) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is propan-2-yl 6-ethoxy-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 6-ethoxy-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 175151411 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | propan-2-yl 6-ethoxy-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCOC1C=CC=CC1(C(=O)OC(C)C)C(C)C |
| InChI | InChI=1S/C15H24O3/c1-6-17-13-9-7-8-10-15(13,11(2)3)14(16)18-12(4)5/h7-13H,6H2,1-5H3 |
| InChIKey | KTNAVRIEJXYTQB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 6-ethoxy-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 6-ethoxy-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of propan-2-yl 6-ethoxy-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylate (CID 175151411) is propan-2-yl 6-ethoxy-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for propan-2-yl 6-ethoxy-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for propan-2-yl 6-ethoxy-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylate is CCOC1C=CC=CC1(C(=O)OC(C)C)C(C)C.
What is the InChIKey of propan-2-yl 6-ethoxy-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylate?
The InChIKey is KTNAVRIEJXYTQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-6-17-13-9-7-8-10-15(13,11(2)3)14(16)18-12(4)5/h7-13H,6H2,1-5H3.
What are the key properties of propan-2-yl 6-ethoxy-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylate?
propan-2-yl 6-ethoxy-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylate has a molecular weight of 252.35 g/mol, XLogP of 3.11, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 6-ethoxy-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 175151411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).