C24H30N6O3S2 — CID 175151455
(5S)-5-[aminocarbamothioyl-(2-methoxy-4-pyridinyl)amino]-2-(cyclopropanecarbonylamino)-N-(cyclopropylmethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 175151455) has the molecular formula C24H30N6O3S2 and a molecular weight of 514.68 g/mol. Its IUPAC name is (5S)-5-[aminocarbamothioyl-(2-methoxy-4-pyridinyl)amino]-2-(cyclopropanecarbonylamino)-N-(cyclopropylmethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (5S)-5-[aminocarbamothioyl-(2-methoxy-4-pyridinyl)amino]-2-(cyclopropanecarbonylamino)-N-(cyclopropylmethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 175151455 |
| Molecular Formula | C24H30N6O3S2 |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | (5S)-5-[aminocarbamothioyl-(2-methoxy-4-pyridinyl)amino]-2-(cyclopropanecarbonylamino)-N-(cyclopropylmethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COc1cc(N(C(=S)NN)[C@H]2CCc3sc(NC(=O)C4CC4)c(C(=O)NCC4CC4)c3C2)ccn1 |
| InChI | InChI=1S/C24H30N6O3S2/c1-33-19-11-16(8-9-26-19)30(24(34)29-25)15-6-7-18-17(10-15)20(22(32)27-12-13-2-3-13)23(35-18)28-21(31)14-4-5-14/h8-9,11,13-15H,2-7,10,12,25H2,1H3,(H,27,32)(H,28,31)(H,29,34)/t15-/m0/s1 |
| InChIKey | YRMHRSAMEJIJOO-HNNXBMFYSA-N |
| XLogP | 2.75 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|