C16H21NO2S — CID 175152052
2,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-1,3-benzothiazole (PubChem CID 175152052) has the molecular formula C16H21NO2S and a molecular weight of 291.42 g/mol. Its IUPAC name is 2,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-1,3-benzothiazole.
| Compound Name | 2,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 175152052 |
| Molecular Formula | C16H21NO2S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-1,3-benzothiazole |
| SMILES | Cc1nc2c(C)cc(C3OC(C)(C)C(C)(C)O3)cc2s1 |
| InChI | InChI=1S/C16H21NO2S/c1-9-7-11(8-12-13(9)17-10(2)20-12)14-18-15(3,4)16(5,6)19-14/h7-8,14H,1-6H3 |
| InChIKey | SDVCZRKIJMEVFL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |