About 3-hydroxyhex-5-yn-2-yl carbamate
3-hydroxyhex-5-yn-2-yl carbamate (PubChem CID 175152503) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is 3-hydroxyhex-5-yn-2-yl carbamate.
Molecular Properties
| Compound Name | 3-hydroxyhex-5-yn-2-yl carbamate |
| PubChem CID | 175152503 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 3-hydroxyhex-5-yn-2-yl carbamate |
| SMILES | C#CCC(O)C(C)OC(N)=O |
| InChI | InChI=1S/C7H11NO3/c1-3-4-6(9)5(2)11-7(8)10/h1,5-6,9H,4H2,2H3,(H2,8,10) |
| InChIKey | DOPWGLCTZHFONY-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyhex-5-yn-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyhex-5-yn-2-yl carbamate?
The IUPAC name of 3-hydroxyhex-5-yn-2-yl carbamate (CID 175152503) is 3-hydroxyhex-5-yn-2-yl carbamate.
What is the SMILES notation for 3-hydroxyhex-5-yn-2-yl carbamate?
The canonical SMILES for 3-hydroxyhex-5-yn-2-yl carbamate is C#CCC(O)C(C)OC(N)=O.
What is the InChIKey of 3-hydroxyhex-5-yn-2-yl carbamate?
The InChIKey is DOPWGLCTZHFONY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-3-4-6(9)5(2)11-7(8)10/h1,5-6,9H,4H2,2H3,(H2,8,10).
What are the key properties of 3-hydroxyhex-5-yn-2-yl carbamate?
3-hydroxyhex-5-yn-2-yl carbamate has a molecular weight of 157.17 g/mol, XLogP of -0.15, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyhex-5-yn-2-yl carbamate is sourced from PubChem (CID 175152503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).