About 2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride
2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride (PubChem CID 175152592) has the molecular formula C5H11ClN4O
and a molecular weight of 178.62 g/mol. Its IUPAC name is 2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride |
| PubChem CID | 175152592 |
| Molecular Formula | C5H11ClN4O |
| Molecular Weight | 178.62 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride |
| SMILES | CC(N)C(O)c1ncn[nH]1.Cl |
| InChI | InChI=1S/C5H10N4O.ClH/c1-3(6)4(10)5-7-2-8-9-5;/h2-4,10H,6H2,1H3,(H,7,8,9);1H |
| InChIKey | JCICJEIILYGMHU-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.62 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride?
The IUPAC name of 2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride (CID 175152592) is 2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride.
What is the SMILES notation for 2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride?
The canonical SMILES for 2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride is CC(N)C(O)c1ncn[nH]1.Cl.
What is the InChIKey of 2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride?
The InChIKey is JCICJEIILYGMHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4O.ClH/c1-3(6)4(10)5-7-2-8-9-5;/h2-4,10H,6H2,1H3,(H,7,8,9);1H.
What are the key properties of 2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride?
2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride has a molecular weight of 178.62 g/mol, XLogP of -0.39, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride is sourced from PubChem (CID 175152592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).