C17H13N5O5S — CID 175153096
2-[[2-(3,4-dihydropyrazol-2-yl)phenyl]sulfanylmethyl]-5,6-dinitro-1,3-benzoxazole (PubChem CID 175153096) has the molecular formula C17H13N5O5S and a molecular weight of 399.39 g/mol. Its IUPAC name is 2-[[2-(3,4-dihydropyrazol-2-yl)phenyl]sulfanylmethyl]-5,6-dinitro-1,3-benzoxazole.
| Compound Name | 2-[[2-(3,4-dihydropyrazol-2-yl)phenyl]sulfanylmethyl]-5,6-dinitro-1,3-benzoxazole |
|---|---|
| PubChem CID | 175153096 |
| Molecular Formula | C17H13N5O5S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 2-[[2-(3,4-dihydropyrazol-2-yl)phenyl]sulfanylmethyl]-5,6-dinitro-1,3-benzoxazole |
| SMILES | O=[N+]([O-])c1cc2nc(CSc3ccccc3N3CCC=N3)oc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13N5O5S/c23-21(24)13-8-11-15(9-14(13)22(25)26)27-17(19-11)10-28-16-5-2-1-4-12(16)20-7-3-6-18-20/h1-2,4-6,8-9H,3,7,10H2 |
| InChIKey | VWXJSTCARVLPPC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 127.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|