About (5-methylimidazol-1-yl) acetate
(5-methylimidazol-1-yl) acetate (PubChem CID 175153619) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is (5-methylimidazol-1-yl) acetate.
Molecular Properties
| Compound Name | (5-methylimidazol-1-yl) acetate |
| PubChem CID | 175153619 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | (5-methylimidazol-1-yl) acetate |
| SMILES | CC(=O)On1cncc1C |
| InChI | InChI=1S/C6H8N2O2/c1-5-3-7-4-8(5)10-6(2)9/h3-4H,1-2H3 |
| InChIKey | KOWOQDSUXOBDJI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methylimidazol-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methylimidazol-1-yl) acetate?
The IUPAC name of (5-methylimidazol-1-yl) acetate (CID 175153619) is (5-methylimidazol-1-yl) acetate.
What is the SMILES notation for (5-methylimidazol-1-yl) acetate?
The canonical SMILES for (5-methylimidazol-1-yl) acetate is CC(=O)On1cncc1C.
What is the InChIKey of (5-methylimidazol-1-yl) acetate?
The InChIKey is KOWOQDSUXOBDJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c1-5-3-7-4-8(5)10-6(2)9/h3-4H,1-2H3.
What are the key properties of (5-methylimidazol-1-yl) acetate?
(5-methylimidazol-1-yl) acetate has a molecular weight of 140.14 g/mol, XLogP of 0.17, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methylimidazol-1-yl) acetate is sourced from PubChem (CID 175153619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).