C23H29NO4 — CID 175153951
2-[1-(dibenzylamino)-4-methylpentyl]propanedioic acid (PubChem CID 175153951) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-[1-(dibenzylamino)-4-methylpentyl]propanedioic acid.
| Compound Name | 2-[1-(dibenzylamino)-4-methylpentyl]propanedioic acid |
|---|---|
| PubChem CID | 175153951 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 2-[1-(dibenzylamino)-4-methylpentyl]propanedioic acid |
| SMILES | CC(C)CCC(C(C(=O)O)C(=O)O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H29NO4/c1-17(2)13-14-20(21(22(25)26)23(27)28)24(15-18-9-5-3-6-10-18)16-19-11-7-4-8-12-19/h3-12,17,20-21H,13-16H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | GVUYFYWWAYQMGZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|