About 5-diazocyclohexa-1,3-diene;perylene
5-diazocyclohexa-1,3-diene;perylene (PubChem CID 175154299) has the molecular formula C26H18N2
and a molecular weight of 358.44 g/mol. Its IUPAC name is 5-diazocyclohexa-1,3-diene;perylene.
Molecular Properties
| Compound Name | 5-diazocyclohexa-1,3-diene;perylene |
| PubChem CID | 175154299 |
| Molecular Formula | C26H18N2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 5-diazocyclohexa-1,3-diene;perylene |
| SMILES | [N-]=[N+]=C1C=CC=CC1.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.C6H6N2/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;7-8-6-4-2-1-3-5-6/h1-12H;1-4H,5H2 |
| InChIKey | FAUYXEAAMLYETG-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5-diazocyclohexa-1,3-diene;perylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-diazocyclohexa-1,3-diene;perylene?
The IUPAC name of 5-diazocyclohexa-1,3-diene;perylene (CID 175154299) is 5-diazocyclohexa-1,3-diene;perylene.
What is the SMILES notation for 5-diazocyclohexa-1,3-diene;perylene?
The canonical SMILES for 5-diazocyclohexa-1,3-diene;perylene is [N-]=[N+]=C1C=CC=CC1.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54.
What is the InChIKey of 5-diazocyclohexa-1,3-diene;perylene?
The InChIKey is FAUYXEAAMLYETG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12.C6H6N2/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;7-8-6-4-2-1-3-5-6/h1-12H;1-4H,5H2.
What are the key properties of 5-diazocyclohexa-1,3-diene;perylene?
5-diazocyclohexa-1,3-diene;perylene has a molecular weight of 358.44 g/mol, XLogP of 6.91, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-diazocyclohexa-1,3-diene;perylene is sourced from PubChem (CID 175154299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).