About methyl 4-amino-3,6-dichloro-6-(6-chloro-3-pyridinyl)-1H-pyridine-2-carboxylate
methyl 4-amino-3,6-dichloro-6-(6-chloro-3-pyridinyl)-1H-pyridine-2-carboxylate (PubChem CID 175154960) has the molecular formula C12H10Cl3N3O2
and a molecular weight of 334.59 g/mol. Its IUPAC name is methyl 4-amino-3,6-dichloro-6-(6-chloro-3-pyridinyl)-1H-pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-amino-3,6-dichloro-6-(6-chloro-3-pyridinyl)-1H-pyridine-2-carboxylate |
| PubChem CID | 175154960 |
| Molecular Formula | C12H10Cl3N3O2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | methyl 4-amino-3,6-dichloro-6-(6-chloro-3-pyridinyl)-1H-pyridine-2-carboxylate |
| SMILES | COC(=O)C1=C(Cl)C(N)=CC(Cl)(c2ccc(Cl)nc2)N1 |
| InChI | InChI=1S/C12H10Cl3N3O2/c1-20-11(19)10-9(14)7(16)4-12(15,18-10)6-2-3-8(13)17-5-6/h2-5,18H,16H2,1H3 |
| InChIKey | XEFBHJFUTDLFRB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-amino-3,6-dichloro-6-(6-chloro-3-pyridinyl)-1H-pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-3,6-dichloro-6-(6-chloro-3-pyridinyl)-1H-pyridine-2-carboxylate?
The IUPAC name of methyl 4-amino-3,6-dichloro-6-(6-chloro-3-pyridinyl)-1H-pyridine-2-carboxylate (CID 175154960) is methyl 4-amino-3,6-dichloro-6-(6-chloro-3-pyridinyl)-1H-pyridine-2-carboxylate.
What is the SMILES notation for methyl 4-amino-3,6-dichloro-6-(6-chloro-3-pyridinyl)-1H-pyridine-2-carboxylate?
The canonical SMILES for methyl 4-amino-3,6-dichloro-6-(6-chloro-3-pyridinyl)-1H-pyridine-2-carboxylate is COC(=O)C1=C(Cl)C(N)=CC(Cl)(c2ccc(Cl)nc2)N1.
What is the InChIKey of methyl 4-amino-3,6-dichloro-6-(6-chloro-3-pyridinyl)-1H-pyridine-2-carboxylate?
The InChIKey is XEFBHJFUTDLFRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl3N3O2/c1-20-11(19)10-9(14)7(16)4-12(15,18-10)6-2-3-8(13)17-5-6/h2-5,18H,16H2,1H3.
What are the key properties of methyl 4-amino-3,6-dichloro-6-(6-chloro-3-pyridinyl)-1H-pyridine-2-carboxylate?
methyl 4-amino-3,6-dichloro-6-(6-chloro-3-pyridinyl)-1H-pyridine-2-carboxylate has a molecular weight of 334.59 g/mol, XLogP of 2.20, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-3,6-dichloro-6-(6-chloro-3-pyridinyl)-1H-pyridine-2-carboxylate is sourced from PubChem (CID 175154960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).