About O-[aminooxy-(2-aminophenyl)boranyl]hydroxylamine;platinum
O-[aminooxy-(2-aminophenyl)boranyl]hydroxylamine;platinum (PubChem CID 175156732) has the molecular formula C6H10BN3O2Pt
and a molecular weight of 362.06 g/mol. Its IUPAC name is O-[aminooxy-(2-aminophenyl)boranyl]hydroxylamine;platinum.
Molecular Properties
| Compound Name | O-[aminooxy-(2-aminophenyl)boranyl]hydroxylamine;platinum |
| PubChem CID | 175156732 |
| Molecular Formula | C6H10BN3O2Pt |
| Molecular Weight | 362.06 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | O-[aminooxy-(2-aminophenyl)boranyl]hydroxylamine;platinum |
| SMILES | NOB(ON)c1ccccc1N.[Pt] |
| InChI | InChI=1S/C6H10BN3O2.Pt/c8-6-4-2-1-3-5(6)7(11-9)12-10;/h1-4H,8-10H2; |
| InChIKey | DLQLQJBYRJRHNN-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.06 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[aminooxy-(2-aminophenyl)boranyl]hydroxylamine;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[aminooxy-(2-aminophenyl)boranyl]hydroxylamine;platinum?
The IUPAC name of O-[aminooxy-(2-aminophenyl)boranyl]hydroxylamine;platinum (CID 175156732) is O-[aminooxy-(2-aminophenyl)boranyl]hydroxylamine;platinum.
What is the SMILES notation for O-[aminooxy-(2-aminophenyl)boranyl]hydroxylamine;platinum?
The canonical SMILES for O-[aminooxy-(2-aminophenyl)boranyl]hydroxylamine;platinum is NOB(ON)c1ccccc1N.[Pt].
What is the InChIKey of O-[aminooxy-(2-aminophenyl)boranyl]hydroxylamine;platinum?
The InChIKey is DLQLQJBYRJRHNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10BN3O2.Pt/c8-6-4-2-1-3-5(6)7(11-9)12-10;/h1-4H,8-10H2;.
What are the key properties of O-[aminooxy-(2-aminophenyl)boranyl]hydroxylamine;platinum?
O-[aminooxy-(2-aminophenyl)boranyl]hydroxylamine;platinum has a molecular weight of 362.06 g/mol, XLogP of -1.26, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-[aminooxy-(2-aminophenyl)boranyl]hydroxylamine;platinum is sourced from PubChem (CID 175156732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).