About 2-(oxaziridin-3-yl)phenol;trichlorochromium
2-(oxaziridin-3-yl)phenol;trichlorochromium (PubChem CID 175156745) has the molecular formula C7H7Cl3CrNO2
and a molecular weight of 295.49 g/mol. Its IUPAC name is 2-(oxaziridin-3-yl)phenol;trichlorochromium.
Molecular Properties
| Compound Name | 2-(oxaziridin-3-yl)phenol;trichlorochromium |
| PubChem CID | 175156745 |
| Molecular Formula | C7H7Cl3CrNO2 |
| Molecular Weight | 295.49 g/mol |
| Exact Mass | 293.89 |
| IUPAC Name | 2-(oxaziridin-3-yl)phenol;trichlorochromium |
| SMILES | Cl[Cr](Cl)Cl.Oc1ccccc1C1NO1 |
| InChI | InChI=1S/C7H7NO2.3ClH.Cr/c9-6-4-2-1-3-5(6)7-8-10-7;;;;/h1-4,7-9H;3*1H;/q;;;;+3/p-3 |
| InChIKey | JZNBMKUJDGJTGB-UHFFFAOYSA-K |
| XLogP | 2.99 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxaziridin-3-yl)phenol;trichlorochromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxaziridin-3-yl)phenol;trichlorochromium?
The IUPAC name of 2-(oxaziridin-3-yl)phenol;trichlorochromium (CID 175156745) is 2-(oxaziridin-3-yl)phenol;trichlorochromium.
What is the SMILES notation for 2-(oxaziridin-3-yl)phenol;trichlorochromium?
The canonical SMILES for 2-(oxaziridin-3-yl)phenol;trichlorochromium is Cl[Cr](Cl)Cl.Oc1ccccc1C1NO1.
What is the InChIKey of 2-(oxaziridin-3-yl)phenol;trichlorochromium?
The InChIKey is JZNBMKUJDGJTGB-UHFFFAOYSA-K. The full InChI is InChI=1S/C7H7NO2.3ClH.Cr/c9-6-4-2-1-3-5(6)7-8-10-7;;;;/h1-4,7-9H;3*1H;/q;;;;+3/p-3.
What are the key properties of 2-(oxaziridin-3-yl)phenol;trichlorochromium?
2-(oxaziridin-3-yl)phenol;trichlorochromium has a molecular weight of 295.49 g/mol, XLogP of 2.99, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxaziridin-3-yl)phenol;trichlorochromium is sourced from PubChem (CID 175156745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).