C18H14ClF2N3OS — CID 175157102
4-[(2R,3R)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxetan-2-yl]-2-methyl-1,2,4-triazole-3-thione (PubChem CID 175157102) has the molecular formula C18H14ClF2N3OS and a molecular weight of 393.85 g/mol. Its IUPAC name is 4-[(2R,3R)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxetan-2-yl]-2-methyl-1,2,4-triazole-3-thione.
| Compound Name | 4-[(2R,3R)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxetan-2-yl]-2-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 175157102 |
| Molecular Formula | C18H14ClF2N3OS |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 4-[(2R,3R)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxetan-2-yl]-2-methyl-1,2,4-triazole-3-thione |
| SMILES | Cn1ncn([C@@]2(c3ccc(F)cc3F)OC[C@H]2c2ccccc2Cl)c1=S |
| InChI | InChI=1S/C18H14ClF2N3OS/c1-23-17(26)24(10-22-23)18(13-7-6-11(20)8-16(13)21)14(9-25-18)12-4-2-3-5-15(12)19/h2-8,10,14H,9H2,1H3/t14-,18-/m0/s1 |
| InChIKey | KPXKNJMTVBGBSN-KSSFIOAISA-N |
| XLogP | 4.40 |
| TPSA | 31.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|